Products 857818-41-8
CAS 857818-41-8 is the registry number for Ambrisentan Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dihydroxy-3,3-diphenylpropanoic acid (CAS 857818-41-8) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 2,3-dihydroxy-3,3-diphenylpropanoic acid. InChIKey: CGZUJOSEECYBRW-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 2,3-dihydroxy-3,3-diphenylpropanoic acid |
| InChIKey | CGZUJOSEECYBRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C(C(=O)O)O)O |
Computed by PubChem (NCBI)