Products 85806-18-4
CAS 85806-18-4 appears in our catalog under these names: delta–Valerobetaine–d9 chloride, delta-Valerobetaine-d9 (chloride), 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
4-carboxybutyl-tris(trideuteriomethyl)azanium chloride (CAS 85806-18-4) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 204.74 g/mol. IUPAC name: 4-carboxybutyl-tris(trideuteriomethyl)azanium chloride. InChIKey: STKSGQDPTZXSOU-KYRNGWDOSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 204.74 g/mol |
| IUPAC name | 4-carboxybutyl-tris(trideuteriomethyl)azanium chloride |
| InChIKey | STKSGQDPTZXSOU-KYRNGWDOSA-N |
| SMILES | [2H]C([2H])([2H])[N+](CCCCC(=O)O)(C([2H])([2H])[2H])C([2H])([2H])[2H].[Cl-] |
Computed by PubChem (NCBI)