Products 858193-23-4
CAS 858193-23-4 is the registry number for 1-Acetyl-7-bromoindolin-5-amine, 95%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
1-(5-amino-7-bromo-2,3-dihydroindol-1-yl)ethanone (CAS 858193-23-4) is a chemical compound with the molecular formula C10H11BrN2O and a molecular weight of 255.11 g/mol. IUPAC name: 1-(5-amino-7-bromo-2,3-dihydroindol-1-yl)ethanone. InChIKey: DSPOGIZSYHNAPN-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2O |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 1-(5-amino-7-bromo-2,3-dihydroindol-1-yl)ethanone |
| InChIKey | DSPOGIZSYHNAPN-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1C(=CC(=C2)N)Br |
Computed by PubChem (NCBI)