Products 858215-75-5

CAS 858215-75-5 is the registry number for 2-Cyano-3-(o-tolyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-cyano-3-(2-methylphenyl)propanoic acid (CAS 858215-75-5) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 2-cyano-3-(2-methylphenyl)propanoic acid. InChIKey: UQBQUSZVVRQDAU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO2
Molecular weight189.21 g/mol
IUPAC name2-cyano-3-(2-methylphenyl)propanoic acid
InChIKeyUQBQUSZVVRQDAU-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1CC(C#N)C(=O)O

Computed by PubChem (NCBI)