CAS 85916-13-8 appears in our catalog under these names: NH-bis(C1-Boc), NH–bis(C1–Boc), Di-tert-butyl Iminodiacetate, >97.0%(GC), Di-tert-butyl iminodiacetate, 97%, NH-bis(C1-Boc) 97%. Offered by: TargetMol, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 500mg, 1g, 5g, 250mg, 10g, 25g, 100g, 50g.
Tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate (CAS 85916-13-8) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate. InChIKey: SMXMBXPLRFTROI-UHFFFAOYSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | tert-butyl 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]acetate |
| InChIKey | SMXMBXPLRFTROI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CNCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)