Products 859210-30-3
CAS 859210-30-3 appears in our catalog under these names: Cyclopentyl (2s)-2-aminopropanoate hydrochloride, 95%, cyclopentyl l-alaninate hcl. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
Cyclopentyl (2S)-2-aminopropanoate;hydrochloride (CAS 859210-30-3) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: cyclopentyl (2S)-2-aminopropanoate;hydrochloride. InChIKey: QGLPWWNULTZBHA-RGMNGODLSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | cyclopentyl (2S)-2-aminopropanoate;hydrochloride |
| InChIKey | QGLPWWNULTZBHA-RGMNGODLSA-N |
| SMILES | C[C@@H](C(=O)OC1CCCC1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
cyclopentyl (2S)-2-aminopropanoate hydrochloride, cyclopentyl l-alaninate hcl, cyclopentyl (2S)-2-aminopropanoate;hydrochloride, L-alanine cyclopentyl ester hydrochloride, (S)-Cyclopentyl 2-aminopropanoate hydrochloride, L-Alanine cyclopentyl ester HCl, Cyclopentyl L-alaninate hydrochloride