CAS 859538-51-5 is the registry number for 1-(4-Hydroxyphenyl)pyridin-2(1H)-one. Offered by: TRC. Available pack sizes: 10mg, 2mg, 5mg.
1-(4-hydroxyphenyl)pyridin-2-one (CAS 859538-51-5) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 1-(4-hydroxyphenyl)pyridin-2-one. InChIKey: ORCWDXURTHUZTK-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 1-(4-hydroxyphenyl)pyridin-2-one |
| InChIKey | ORCWDXURTHUZTK-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C=C1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)