CAS 860193-45-9 appears in our catalog under these names: 5-Iodoquinazolin-4(3H)-one, 95+%, 5-Iodoquinazolin-4-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
5-iodo-3H-quinazolin-4-one (CAS 860193-45-9) is a chemical compound with the molecular formula C8H5IN2O and a molecular weight of 272.04 g/mol. IUPAC name: 5-iodo-3H-quinazolin-4-one. InChIKey: NLTHTTIZUVYMQH-UHFFFAOYSA-N.
| Molecular formula | C8H5IN2O |
|---|---|
| Molecular weight | 272.04 g/mol |
| IUPAC name | 5-iodo-3H-quinazolin-4-one |
| InChIKey | NLTHTTIZUVYMQH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)I)C(=O)NC=N2 |
Computed by PubChem (NCBI)