Products 860218-13-9
CAS 860218-13-9 is the registry number for N-(2-(3-Methylbenzoyl)phenyl)acetamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
N-[2-(3-methylbenzoyl)phenyl]acetamide (CAS 860218-13-9) is a chemical compound with the molecular formula C16H15NO2 and a molecular weight of 253.29 g/mol. IUPAC name: N-[2-(3-methylbenzoyl)phenyl]acetamide. InChIKey: AFKTXWFGFBOOIJ-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | N-[2-(3-methylbenzoyl)phenyl]acetamide |
| InChIKey | AFKTXWFGFBOOIJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)C2=CC=CC=C2NC(=O)C |
Computed by PubChem (NCBI)