Products 860699-55-4
CAS 860699-55-4 is the registry number for 3-Phenylmethanesulfonamidobenzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-(benzylsulfonylamino)benzoic acid (CAS 860699-55-4) is a chemical compound with the molecular formula C14H13NO4S and a molecular weight of 291.32 g/mol. IUPAC name: 3-(benzylsulfonylamino)benzoic acid. InChIKey: QIKUOKKSPSEHEY-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4S |
|---|---|
| Molecular weight | 291.32 g/mol |
| IUPAC name | 3-(benzylsulfonylamino)benzoic acid |
| InChIKey | QIKUOKKSPSEHEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CS(=O)(=O)NC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)