Products 861080-52-6

CAS 861080-52-6 is the registry number for 3-(Ethanesulfonyl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-ethylsulfonylbenzenesulfonyl chloride (CAS 861080-52-6) is a chemical compound with the molecular formula C8H9ClO4S2 and a molecular weight of 268.7 g/mol. IUPAC name: 3-ethylsulfonylbenzenesulfonyl chloride. InChIKey: JRQHHZNOHIKOCF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClO4S2
Molecular weight268.7 g/mol
IUPAC name3-ethylsulfonylbenzenesulfonyl chloride
InChIKeyJRQHHZNOHIKOCF-UHFFFAOYSA-N
SMILESCCS(=O)(=O)C1=CC(=CC=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)