CAS 861207-68-3 appears in our catalog under these names: 3-Chloro-4-methoxybenzenecarbaldehyde oxime, 95%, N-((3-Chloro-4-methoxyphenyl)methylidene)hydroxylamine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg.
(NE)-N-[(3-chloro-4-methoxyphenyl)methylidene]hydroxylamine (CAS 861207-68-3) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: (NE)-N-[(3-chloro-4-methoxyphenyl)methylidene]hydroxylamine. InChIKey: HVLSMUKUKRFWAQ-BJMVGYQFSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | (NE)-N-[(3-chloro-4-methoxyphenyl)methylidene]hydroxylamine |
| InChIKey | HVLSMUKUKRFWAQ-BJMVGYQFSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=N/O)Cl |
Computed by PubChem (NCBI)