CAS 86123-05-9 is the registry number for (R)-Benzyl aziridine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2R)-aziridine-2-carboxylate (CAS 86123-05-9) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: benzyl (2R)-aziridine-2-carboxylate. InChIKey: DYTLUPYGICQKHJ-SECBINFHSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | benzyl (2R)-aziridine-2-carboxylate |
| InChIKey | DYTLUPYGICQKHJ-SECBINFHSA-N |
| SMILES | C1[C@@H](N1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)