Products 861306-45-8
CAS 861306-45-8 is the registry number for METHYL 5-CHLORO-2-(METHYLSULFANYL)BENZOATE, ≥96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 5-chloro-2-methylsulfanylbenzoate (CAS 861306-45-8) is a chemical compound with the molecular formula C9H9ClO2S and a molecular weight of 216.68 g/mol. IUPAC name: methyl 5-chloro-2-methylsulfanylbenzoate. InChIKey: POLWSLXLMYZICR-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2S |
|---|---|
| Molecular weight | 216.68 g/mol |
| IUPAC name | methyl 5-chloro-2-methylsulfanylbenzoate |
| InChIKey | POLWSLXLMYZICR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Cl)SC |
Computed by PubChem (NCBI)