CAS 861417-45-0 is the registry number for Ethyl 3-(2-chloropyridin-4-yl)-3-oxopropanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 3-(2-chloro-4-pyridinyl)-3-oxopropanoate (CAS 861417-45-0) is a chemical compound with the molecular formula C10H10ClNO3 and a molecular weight of 227.64 g/mol. IUPAC name: ethyl 3-(2-chloro-4-pyridinyl)-3-oxopropanoate. InChIKey: VQESHCXOMUBUOE-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO3 |
|---|---|
| Molecular weight | 227.64 g/mol |
| IUPAC name | ethyl 3-(2-chloro-4-pyridinyl)-3-oxopropanoate |
| InChIKey | VQESHCXOMUBUOE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC(=NC=C1)Cl |
Computed by PubChem (NCBI)