Products 861440-59-7
CAS 861440-59-7 appears in our catalog under these names: 4-Bromo-2-phenyloxazole, 4-Bromo-2-phenyloxazole, 97%, 4-Bromo-2-phenyloxazole, 98%. Offered by: Biosynth, Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 2,5g, 250mg, 1g, 5g, 100mg.
4-bromo-2-phenyl-1,3-oxazole (CAS 861440-59-7) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 4-bromo-2-phenyl-1,3-oxazole. InChIKey: NIHUUTIZYTZSSW-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 4-bromo-2-phenyl-1,3-oxazole |
| InChIKey | NIHUUTIZYTZSSW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CO2)Br |
Computed by PubChem (NCBI)