CAS 86147-33-3 appears in our catalog under these names: 2-(Toluene-4-sulfonyl)-propionic acid hydrazide, 95+%, 2-(4-toluenesulfonyl)propionic acid hydrazide, 2-(Toluene-4-sulfonyl)-propionic acid hydrazide, 98%. Offered by: Chemat Brand, Biosynth, Fluorochem. Available pack sizes: on request, 10g, 5g, 1g.
2-(4-methylphenyl)sulfonylpropanehydrazide (CAS 86147-33-3) is a chemical compound with the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. IUPAC name: 2-(4-methylphenyl)sulfonylpropanehydrazide. InChIKey: DLXMNXIZLQNXBX-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O3S |
|---|---|
| Molecular weight | 242.30 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfonylpropanehydrazide |
| InChIKey | DLXMNXIZLQNXBX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C)C(=O)NN |
Computed by PubChem (NCBI)