Products 86150-37-0

CAS 86150-37-0 is the registry number for 2-METHOXYETHYL L-PHENYLALANINATE HYDROCHLORIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-methoxyethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride (CAS 86150-37-0) is a chemical compound with the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. IUPAC name: 2-methoxyethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride. InChIKey: RAKLKBOAQXTHMX-MERQFXBCSA-N.

Identity
Molecular formulaC12H18ClNO3
Molecular weight259.73 g/mol
IUPAC name2-methoxyethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride
InChIKeyRAKLKBOAQXTHMX-MERQFXBCSA-N
SMILESCOCCOC(=O)[C@H](CC1=CC=CC=C1)N.Cl

Computed by PubChem (NCBI)