Products 862896-30-8
CAS 862896-30-8 appears in our catalog under these names: S 38093, 95%, S 38093/ 99.98% (existing batch purity), S 38093, S 38093, 4-(3-(Hexahydrocyclopenta[c]pyrrol-2(1H)-yl)propoxy)benzamide, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 2mg, 5mg, 10mg, 25mg, 50mg, 200mg, 1mg.
4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]benzamide (CAS 862896-30-8) is a chemical compound with the molecular formula C17H24N2O2 and a molecular weight of 288.4 g/mol. IUPAC name: 4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]benzamide. InChIKey: MRNMYWNBLVJWKG-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O2 |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]benzamide |
| InChIKey | MRNMYWNBLVJWKG-UHFFFAOYSA-N |
| SMILES | C1CC2CN(CC2C1)CCCOC3=CC=C(C=C3)C(=O)N |
Computed by PubChem (NCBI)