CAS 86347-35-5 is the registry number for Medetomidine Impurity 81. Offered by: Chemat Brand. Available pack sizes: on request.
5-[1-(2,6-dimethylphenyl)ethyl]-1H-imidazole (CAS 86347-35-5) is a chemical compound with the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. IUPAC name: 5-[1-(2,6-dimethylphenyl)ethyl]-1H-imidazole. InChIKey: CMSHTOBHDXZAPP-UHFFFAOYSA-N.
| Molecular formula | C13H16N2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | 5-[1-(2,6-dimethylphenyl)ethyl]-1H-imidazole |
| InChIKey | CMSHTOBHDXZAPP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C(C)C2=CN=CN2 |
Computed by PubChem (NCBI)