CAS 863786-19-0 is the registry number for Methyl 1,4-dihydro-6-methoxy-4-oxo-quinoline-7-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Methyl 6-methoxy-4-oxo-1H-quinoline-7-carboxylate (CAS 863786-19-0) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: methyl 6-methoxy-4-oxo-1H-quinoline-7-carboxylate. InChIKey: GUFWOLGMEYBTHR-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | methyl 6-methoxy-4-oxo-1H-quinoline-7-carboxylate |
| InChIKey | GUFWOLGMEYBTHR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C=CN2)C(=O)OC |
Computed by PubChem (NCBI)