Products 864149-20-2
CAS 864149-20-2 is the registry number for 1-[3-(3-Bromophenyl)phenyl]ethan-1-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[3-(3-bromophenyl)phenyl]ethanone (CAS 864149-20-2) is a chemical compound with the molecular formula C14H11BrO and a molecular weight of 275.14 g/mol. IUPAC name: 1-[3-(3-bromophenyl)phenyl]ethanone. InChIKey: NRKOUBFBSBWSDD-UHFFFAOYSA-N.
| Molecular formula | C14H11BrO |
|---|---|
| Molecular weight | 275.14 g/mol |
| IUPAC name | 1-[3-(3-bromophenyl)phenyl]ethanone |
| InChIKey | NRKOUBFBSBWSDD-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC(=C1)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)