CAS 864291-33-8 appears in our catalog under these names: 6-(Trifluoromethyl)quinazoline-2,4(1H,3H)-dione, 98+%, 6-(trifluoromethyl)-1,2,3,4-tetrahydroquinazoline-2,4-dione, 98%, 6-(TRIFLUOROMETHYL)QUINAZOLINE-2,4(1H,3H)-DIONE, 95%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 100mg, 5g, 250mg, 1g.
6-(trifluoromethyl)-1H-quinazoline-2,4-dione (CAS 864291-33-8) is a chemical compound with the molecular formula C9H5F3N2O2 and a molecular weight of 230.14 g/mol. IUPAC name: 6-(trifluoromethyl)-1H-quinazoline-2,4-dione. InChIKey: ARSVFINRONYDSE-UHFFFAOYSA-N.
| Molecular formula | C9H5F3N2O2 |
|---|---|
| Molecular weight | 230.14 g/mol |
| IUPAC name | 6-(trifluoromethyl)-1H-quinazoline-2,4-dione |
| InChIKey | ARSVFINRONYDSE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)