Products 86445-22-9
CAS 86445-22-9 appears in our catalog under these names: Auxinole, >95% (HPLC), Auxinole/ 98.93% (existing batch purity), Auxinole, Auxinole 98%, 4-(2,4-Dimethylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid, 98%, 98%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 500mg, 50mg, 1mg, 5mg, 10mg, 25mg, 100mg.
4-(2,4-dimethylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid (CAS 86445-22-9) is a chemical compound with the molecular formula C20H19NO3 and a molecular weight of 321.4 g/mol. IUPAC name: 4-(2,4-dimethylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid. InChIKey: HGUYAIJBXSQXGV-UHFFFAOYSA-N.
| Molecular formula | C20H19NO3 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 4-(2,4-dimethylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid |
| InChIKey | HGUYAIJBXSQXGV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)CC(C2=CNC3=CC=CC=C32)C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
Auxinole, 4-(2,4-dimethylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid, alpha-[2-(2,4-Dimethylphenyl)-2-oxoethyl]-1H-Indole-3-acetic Acid;, orb1217572, orb1308623, s6960, |A-[2-(2,4-Dimethylphenyl)-2-oxoethyl]-1H-indole-3-acetic acid, 4-(2,4-dimethylphenyl)-2-(1H-indol-3-yl)-4-oxidanylidene-butanoic acid