Products 864668-87-1
CAS 864668-87-1 appears in our catalog under these names: ENMD-1198, ENMD-1198, 98.87%, ENMD-1198, 98%. Offered by: Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 10 mg, 25 mg, 50 mg.
(8S,9S,13R,14S)-2-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide (CAS 864668-87-1) is a chemical compound with the molecular formula C20H25NO2 and a molecular weight of 311.4 g/mol. IUPAC name: (8S,9S,13R,14S)-2-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide. InChIKey: YQJWOUQGXATDAE-ACNBBOPNSA-N.
| Molecular formula | C20H25NO2 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | (8S,9S,13R,14S)-2-methoxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxamide |
| InChIKey | YQJWOUQGXATDAE-ACNBBOPNSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC=C2)CCC4=CC(=C(C=C34)OC)C(=O)N |
Computed by PubChem (NCBI)