CAS 865233-36-9 appears in our catalog under these names: (S)-Methyl 3-(4-hydroxyphenyl)hex-4-ynoate, 95%, (3S)-3-(4-Hydroxyphenyl)-4-hexynoic Acid Methyl Ester. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g.
Methyl (3S)-3-(4-hydroxyphenyl)hex-4-ynoate (CAS 865233-36-9) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: methyl (3S)-3-(4-hydroxyphenyl)hex-4-ynoate. InChIKey: BENPHURJTUUUSX-NSHDSACASA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | methyl (3S)-3-(4-hydroxyphenyl)hex-4-ynoate |
| InChIKey | BENPHURJTUUUSX-NSHDSACASA-N |
| SMILES | CC#C[C@@H](CC(=O)OC)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)