Products 866207-69-4
CAS 866207-69-4 appears in our catalog under these names: ethyl (E)–3–(4–(trifluoromethoxy)phenyl)acrylate, ethyl (E)-3-(4-(trifluoromethoxy)phenyl)acrylate. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg.
Ethyl (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoate (CAS 866207-69-4) is a chemical compound with the molecular formula C12H11F3O3 and a molecular weight of 260.21 g/mol. IUPAC name: ethyl (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoate. InChIKey: PIENLWFNVBLMOO-VMPITWQZSA-N.
| Molecular formula | C12H11F3O3 |
|---|---|
| Molecular weight | 260.21 g/mol |
| IUPAC name | ethyl (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoate |
| InChIKey | PIENLWFNVBLMOO-VMPITWQZSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC=C(C=C1)OC(F)(F)F |
Computed by PubChem (NCBI)