Products 866488-35-9

CAS 866488-35-9 is the registry number for N-((5E)-4-Hydroxy-7-oxo-5-octen-1-yl)carbamic Acid Benzyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.

Structural formula: {0} (CAS {1})

Benzyl N-[(E)-4-hydroxy-7-oxooct-5-enyl]carbamate (CAS 866488-35-9) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: benzyl N-[(E)-4-hydroxy-7-oxooct-5-enyl]carbamate. InChIKey: STMLPBMOYVXYLB-MDZDMXLPSA-N.

Identity
Molecular formulaC16H21NO4
Molecular weight291.34 g/mol
IUPAC namebenzyl N-[(E)-4-hydroxy-7-oxooct-5-enyl]carbamate
InChIKeySTMLPBMOYVXYLB-MDZDMXLPSA-N
SMILESCC(=O)/C=C/C(CCCNC(=O)OCC1=CC=CC=C1)O

Computed by PubChem (NCBI)