Products 866620-34-0
CAS 866620-34-0 is the registry number for 1-(6-Aminopyridin-3-yl)pyrrolidin-2-one. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-(6-amino-3-pyridinyl)pyrrolidin-2-one (CAS 866620-34-0) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 1-(6-amino-3-pyridinyl)pyrrolidin-2-one. InChIKey: CTPYSIBFHAXDIM-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 1-(6-amino-3-pyridinyl)pyrrolidin-2-one |
| InChIKey | CTPYSIBFHAXDIM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=CN=C(C=C2)N |
Computed by PubChem (NCBI)