CAS 866767-06-8 is the registry number for 4-Amino-7-bromo-isoindole-1,3-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-amino-7-bromoisoindole-1,3-dione (CAS 866767-06-8) is a chemical compound with the molecular formula C8H5BrN2O2 and a molecular weight of 241.04 g/mol. IUPAC name: 4-amino-7-bromoisoindole-1,3-dione. InChIKey: HUAUVOSVRZPBNM-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O2 |
|---|---|
| Molecular weight | 241.04 g/mol |
| IUPAC name | 4-amino-7-bromoisoindole-1,3-dione |
| InChIKey | HUAUVOSVRZPBNM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1N)C(=O)NC2=O)Br |
Computed by PubChem (NCBI)