CAS 868591-58-6 appears in our catalog under these names: Palbociclib Impurity 54, Palbociclib Impurity 70, 2-Chloro-N-cyclopentylpyrimidin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N-cyclopentylpyrimidin-4-amine (CAS 868591-58-6) is a chemical compound with the molecular formula C9H12ClN3 and a molecular weight of 197.66 g/mol. IUPAC name: 2-chloro-N-cyclopentylpyrimidin-4-amine. InChIKey: RAWKDZURTZRMEB-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 2-chloro-N-cyclopentylpyrimidin-4-amine |
| InChIKey | RAWKDZURTZRMEB-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC2=NC(=NC=C2)Cl |
Computed by PubChem (NCBI)