Products 86867-68-7
CAS 86867-68-7 appears in our catalog under these names: 2-(Difluoromethoxy)phenylacetic acid, 98%, 2-(Difluoromethoxy)phenylacetic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 25g, 5g, 1g, 10g.
2-[2-(difluoromethoxy)phenyl]acetic acid (CAS 86867-68-7) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 2-[2-(difluoromethoxy)phenyl]acetic acid. InChIKey: HQSIEUGDICOLBI-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 2-[2-(difluoromethoxy)phenyl]acetic acid |
| InChIKey | HQSIEUGDICOLBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)OC(F)F |
Computed by PubChem (NCBI)