CAS 869116-13-2 is the registry number for Z-pra-oh, 97%. Offered by: AmBeed. Available pack sizes: 5g.
(2S)-2-(phenylmethoxycarbonylamino)pent-4-ynoic acid (CAS 869116-13-2) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: (2S)-2-(phenylmethoxycarbonylamino)pent-4-ynoic acid. InChIKey: SFMVOEWWTJZRNL-NSHDSACASA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | (2S)-2-(phenylmethoxycarbonylamino)pent-4-ynoic acid |
| InChIKey | SFMVOEWWTJZRNL-NSHDSACASA-N |
| SMILES | C#CC[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)