Products 869872-13-9
CAS 869872-13-9 is the registry number for WAY-326250, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
N-(3-ethylphenyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide (CAS 869872-13-9) is a chemical compound with the molecular formula C16H17N3O3S and a molecular weight of 331.4 g/mol. IUPAC name: N-(3-ethylphenyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide. InChIKey: VLCAVVSOZVVTLN-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O3S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | N-(3-ethylphenyl)-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
| InChIKey | VLCAVVSOZVVTLN-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CC=C1)NC(=O)C2=CC=CN3C2=NS(=O)(=O)CC3 |
Computed by PubChem (NCBI)