CAS 869278-52-4 is the registry number for 2-Amino-3-carbamoyl-4,7-dihydro-5h-thieno[2,3-c]pyridine-6-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Benzyl 2-amino-3-carbamoyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate (CAS 869278-52-4) is a chemical compound with the molecular formula C16H17N3O3S and a molecular weight of 331.4 g/mol. IUPAC name: benzyl 2-amino-3-carbamoyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate. InChIKey: CSPLYXKPMZLUHS-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O3S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | benzyl 2-amino-3-carbamoyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-6-carboxylate |
| InChIKey | CSPLYXKPMZLUHS-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C(=C(S2)N)C(=O)N)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)