Products 1189679-99-9
CAS 1189679-99-9 is the registry number for 5-o-Desmethyl omeprazole-d3. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.
2-[[3,5-dimethyl-4-(trideuteriomethoxy)-2-pyridinyl]methylsulfinyl]-3H-benzimidazol-5-ol (CAS 1189679-99-9) is a chemical compound with the molecular formula C16H17N3O3S and a molecular weight of 334.4 g/mol. IUPAC name: 2-[[3,5-dimethyl-4-(trideuteriomethoxy)-2-pyridinyl]methylsulfinyl]-3H-benzimidazol-5-ol. InChIKey: TWXDTVZNDQKCOS-HPRDVNIFSA-N.
| Molecular formula | C16H17N3O3S |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 2-[[3,5-dimethyl-4-(trideuteriomethoxy)-2-pyridinyl]methylsulfinyl]-3H-benzimidazol-5-ol |
| InChIKey | TWXDTVZNDQKCOS-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C(=NC=C1C)CS(=O)C2=NC3=C(N2)C=C(C=C3)O)C |
Computed by PubChem (NCBI)