CAS 929975-55-3 is the registry number for 1,3,4-Trimethyl-1H-pyrazolo(3,4-b)pyridin-6-yl 4-methylbenzene-1-sulfonate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl) 4-methylbenzenesulfonate (CAS 929975-55-3) is a chemical compound with the molecular formula C16H17N3O3S and a molecular weight of 331.4 g/mol. IUPAC name: (1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl) 4-methylbenzenesulfonate. InChIKey: MYXZTRSNEKWPPA-UHFFFAOYSA-N.
| Molecular formula | C16H17N3O3S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | (1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl) 4-methylbenzenesulfonate |
| InChIKey | MYXZTRSNEKWPPA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=NC3=C(C(=C2)C)C(=NN3C)C |
Computed by PubChem (NCBI)