CAS 7436-62-6 appears in our catalog under these names: S-Benzyl-L-cysteine-4-nitroaniline, 98%, H–Cys(Bzl)–pNA. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g.
(2R)-2-amino-3-benzylsulfanyl-N-(4-nitrophenyl)propanamide (CAS 7436-62-6) is a chemical compound with the molecular formula C16H17N3O3S and a molecular weight of 331.4 g/mol. IUPAC name: (2R)-2-amino-3-benzylsulfanyl-N-(4-nitrophenyl)propanamide. InChIKey: HOZQMLJHNCMSRC-HNNXBMFYSA-N.
| Molecular formula | C16H17N3O3S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | (2R)-2-amino-3-benzylsulfanyl-N-(4-nitrophenyl)propanamide |
| InChIKey | HOZQMLJHNCMSRC-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)CSC[C@@H](C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)