CAS 87009-72-1 appears in our catalog under these names: Metronidazole Impurity 3, 2-(2-Methyl-4-nitro-1H-imidazol-1-yl)ethyl Benzoate. Offered by: Chemat Brand, Mikromol, Biosynth. Available pack sizes: on request, 25mg, 100mg.
2-(2-methyl-4-nitroimidazol-1-yl)ethyl benzoate (CAS 87009-72-1) is a chemical compound with the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. IUPAC name: 2-(2-methyl-4-nitroimidazol-1-yl)ethyl benzoate. InChIKey: BBMOMSXPPYKGBO-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O4 |
|---|---|
| Molecular weight | 275.26 g/mol |
| IUPAC name | 2-(2-methyl-4-nitroimidazol-1-yl)ethyl benzoate |
| InChIKey | BBMOMSXPPYKGBO-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CN1CCOC(=O)C2=CC=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)