Products 870535-27-6
CAS 870535-27-6 appears in our catalog under these names: tert-Butyl 4-chloro-2-(hydroxymethyl)-1H-indole-1-carboxylate, 97%, tert–Butyl 4–chloro–2–(hydroxymethyl)–1H–indole–1–carboxylate. Offered by: AmBeed, GLPBio, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
Tert-butyl 4-chloro-2-(hydroxymethyl)indole-1-carboxylate (CAS 870535-27-6) is a chemical compound with the molecular formula C14H16ClNO3 and a molecular weight of 281.73 g/mol. IUPAC name: tert-butyl 4-chloro-2-(hydroxymethyl)indole-1-carboxylate. InChIKey: MJELCIINMGHXDG-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNO3 |
|---|---|
| Molecular weight | 281.73 g/mol |
| IUPAC name | tert-butyl 4-chloro-2-(hydroxymethyl)indole-1-carboxylate |
| InChIKey | MJELCIINMGHXDG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=C1CO)C(=CC=C2)Cl |
Computed by PubChem (NCBI)