CAS 87109-10-2 appears in our catalog under these names: 3–Phenylpyridin–2–amine, 3-Phenylpyridin-2-amine 95%, 3-phenylpyridin-2-ylamine, 98%, 3-Phenylpyridin-2-amine, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg.
3-phenylpyridin-2-amine (CAS 87109-10-2) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 3-phenylpyridin-2-amine. InChIKey: OJXNUAWQULNUCP-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 3-phenylpyridin-2-amine |
| InChIKey | OJXNUAWQULNUCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=CC=C2)N |
Computed by PubChem (NCBI)