CAS 871112-37-7 is the registry number for 1-Boc-4-(3-chlorophenyl)-4-hydroxypiperidine, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
Tert-butyl 4-(3-chlorophenyl)-4-hydroxypiperidine-1-carboxylate (CAS 871112-37-7) is a chemical compound with the molecular formula C16H22ClNO3 and a molecular weight of 311.80 g/mol. IUPAC name: tert-butyl 4-(3-chlorophenyl)-4-hydroxypiperidine-1-carboxylate. InChIKey: QEACSENDPXQEFE-UHFFFAOYSA-N.
| Molecular formula | C16H22ClNO3 |
|---|---|
| Molecular weight | 311.80 g/mol |
| IUPAC name | tert-butyl 4-(3-chlorophenyl)-4-hydroxypiperidine-1-carboxylate |
| InChIKey | QEACSENDPXQEFE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C2=CC(=CC=C2)Cl)O |
Computed by PubChem (NCBI)