Products 87112-49-0
CAS 87112-49-0 appears in our catalog under these names: Ro 09-0680/ 98.87% (existing batch purity), 2-Isopropyl-8-methylphenanthrene-3,4-dione, Ro 09-0680, 98.87%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 1 mg, 5 mg, 10 mg.
8-methyl-2-propan-2-ylphenanthrene-3,4-dione (CAS 87112-49-0) is a chemical compound with the molecular formula C18H16O2 and a molecular weight of 264.3 g/mol. IUPAC name: 8-methyl-2-propan-2-ylphenanthrene-3,4-dione. InChIKey: SLTQYODWMZBDPJ-UHFFFAOYSA-N.
| Molecular formula | C18H16O2 |
|---|---|
| Molecular weight | 264.3 g/mol |
| IUPAC name | 8-methyl-2-propan-2-ylphenanthrene-3,4-dione |
| InChIKey | SLTQYODWMZBDPJ-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC3=C(C2=CC=C1)C(=O)C(=O)C(=C3)C(C)C |
Computed by PubChem (NCBI)