Products 871498-18-9
CAS 871498-18-9 is the registry number for Methyl (S)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoate, 98%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 50mg, 100mg.
Methyl (2S)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoate (CAS 871498-18-9) is a chemical compound with the molecular formula C12H13FN2O2 and a molecular weight of 236.24 g/mol. IUPAC name: methyl (2S)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoate. InChIKey: ZALWIXKRHZLOLN-JTQLQIEISA-N.
| Molecular formula | C12H13FN2O2 |
|---|---|
| Molecular weight | 236.24 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoate |
| InChIKey | ZALWIXKRHZLOLN-JTQLQIEISA-N |
| SMILES | COC(=O)[C@H](CC1=CNC2=C1C=CC(=C2)F)N |
Computed by PubChem (NCBI)