Products 871571-29-8
CAS 871571-29-8 appears in our catalog under these names: 3-Methyl-4-(trifluoromethyl)benzoic acid, 97%, 3-Methyl-4-(trifluoromethyl)benzoic acid, 3-Methyl-4-(trifluoromethyl)benzoic acid, 95%+, 95%+, 3-METHYL-4-(TRIFLUOROMETHYL)BENZOIC ACID, 95%+. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 2,5g, 100mg.
3-methyl-4-(trifluoromethyl)benzoic acid (CAS 871571-29-8) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 3-methyl-4-(trifluoromethyl)benzoic acid. InChIKey: HTFFMPNQGJHNCD-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 3-methyl-4-(trifluoromethyl)benzoic acid |
| InChIKey | HTFFMPNQGJHNCD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)