CAS 872091-00-4 appears in our catalog under these names: 3-(2-Cyanopropan-2-yl)benzoic acid, 98%, Ketoprofen Impurity 22, 3–(2–Cyanopropan–2–yl)benzoic acid, 3-(2-Cyanopropan-2-yl)benzoic acid, 3-(2-Cyanopropan-2-yl)benzoic acid 98%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Biosynth, Ambeed. Available pack sizes: 5g, 25g, 1g, on request, 10g, 250mg, 100mg, 100g.
3-(2-cyanopropan-2-yl)benzoic acid (CAS 872091-00-4) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 3-(2-cyanopropan-2-yl)benzoic acid. InChIKey: VSCTXXVTZNQKAX-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 3-(2-cyanopropan-2-yl)benzoic acid |
| InChIKey | VSCTXXVTZNQKAX-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)