Products 872496-19-0
CAS 872496-19-0 is the registry number for 3,5-di-tert-butyl-2-ethoxybenzaldehyde, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,5-ditert-butyl-2-ethoxybenzaldehyde (CAS 872496-19-0) is a chemical compound with the molecular formula C17H26O2 and a molecular weight of 262.4 g/mol. IUPAC name: 3,5-ditert-butyl-2-ethoxybenzaldehyde. InChIKey: ZQIYETNDIISIIP-UHFFFAOYSA-N.
| Molecular formula | C17H26O2 |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | 3,5-ditert-butyl-2-ethoxybenzaldehyde |
| InChIKey | ZQIYETNDIISIIP-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1C(C)(C)C)C(C)(C)C)C=O |
Computed by PubChem (NCBI)