CAS 872696-04-3 is the registry number for Benzothiazole, 2-hydrazinyl-6-(1-methylethyl)-, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
(6-propan-2-yl-1,3-benzothiazol-2-yl)hydrazine (CAS 872696-04-3) is a chemical compound with the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. IUPAC name: (6-propan-2-yl-1,3-benzothiazol-2-yl)hydrazine. InChIKey: XPOBNKLISUTFDN-UHFFFAOYSA-N.
| Molecular formula | C10H13N3S |
|---|---|
| Molecular weight | 207.30 g/mol |
| IUPAC name | (6-propan-2-yl-1,3-benzothiazol-2-yl)hydrazine |
| InChIKey | XPOBNKLISUTFDN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)N=C(S2)NN |
Computed by PubChem (NCBI)