CAS 873055-09-5 appears in our catalog under these names: 2–(tert–Butyl)–6–nitro–1H–indole, 2-(tert-Butyl)-6-nitro-1H-indole, 97%, 97%, 2-(TERT-BUTYL)-6-NITRO-1H-INDOLE, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-tert-butyl-6-nitro-1H-indole (CAS 873055-09-5) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 2-tert-butyl-6-nitro-1H-indole. InChIKey: COQNCAZGNLRPHM-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 2-tert-butyl-6-nitro-1H-indole |
| InChIKey | COQNCAZGNLRPHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(N1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)