Products 873548-05-1
CAS 873548-05-1 is the registry number for ethyl 2-(5-ethyl-2-fluorophenyl)-2-oxoacetate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 2-(5-ethyl-2-fluorophenyl)-2-oxoacetate (CAS 873548-05-1) is a chemical compound with the molecular formula C12H13FO3 and a molecular weight of 224.23 g/mol. IUPAC name: ethyl 2-(5-ethyl-2-fluorophenyl)-2-oxoacetate. InChIKey: CCRGJPRVCQXASK-UHFFFAOYSA-N.
| Molecular formula | C12H13FO3 |
|---|---|
| Molecular weight | 224.23 g/mol |
| IUPAC name | ethyl 2-(5-ethyl-2-fluorophenyl)-2-oxoacetate |
| InChIKey | CCRGJPRVCQXASK-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1)F)C(=O)C(=O)OCC |
Computed by PubChem (NCBI)